C20H26BN3O3 — CID 66820018
[4-(2,6,6-trimethyl-7,8-dihydro-5H-quinazolin-4-yl)-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]boronic acid (PubChem CID 66820018) has the molecular formula C20H26BN3O3 and a molecular weight of 367.26 g/mol. Its IUPAC name is [4-(2,6,6-trimethyl-7,8-dihydro-5H-quinazolin-4-yl)-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]boronic acid.
| Compound Name | [4-(2,6,6-trimethyl-7,8-dihydro-5H-quinazolin-4-yl)-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]boronic acid |
|---|---|
| PubChem CID | 66820018 |
| Molecular Formula | C20H26BN3O3 |
| Molecular Weight | 367.26 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | [4-(2,6,6-trimethyl-7,8-dihydro-5H-quinazolin-4-yl)-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]boronic acid |
| SMILES | Cc1nc2c(c(N3CCOc4ccc(B(O)O)cc4C3)n1)CC(C)(C)CC2 |
| InChI | InChI=1S/C20H26BN3O3/c1-13-22-17-6-7-20(2,3)11-16(17)19(23-13)24-8-9-27-18-5-4-15(21(25)26)10-14(18)12-24/h4-5,10,25-26H,6-9,11-12H2,1-3H3 |
| InChIKey | GNWZIVVQJGIXTP-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 78.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|