C21H24N2O — CID 66820966
(3aS,10bS)-2-[(2,4-dimethylphenyl)methyl]-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepin-6-one (PubChem CID 66820966) has the molecular formula C21H24N2O and a molecular weight of 320.44 g/mol. Its IUPAC name is (3aS,10bS)-2-[(2,4-dimethylphenyl)methyl]-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepin-6-one.
| Compound Name | (3aS,10bS)-2-[(2,4-dimethylphenyl)methyl]-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepin-6-one |
|---|---|
| PubChem CID | 66820966 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | (3aS,10bS)-2-[(2,4-dimethylphenyl)methyl]-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepin-6-one |
| SMILES | Cc1ccc(CN2C[C@@H]3CNC(=O)c4ccccc4[C@H]3C2)c(C)c1 |
| InChI | InChI=1S/C21H24N2O/c1-14-7-8-16(15(2)9-14)11-23-12-17-10-22-21(24)19-6-4-3-5-18(19)20(17)13-23/h3-9,17,20H,10-13H2,1-2H3,(H,22,24)/t17-,20-/m0/s1 |
| InChIKey | WCGNFKIPVVYHAD-PXNSSMCTSA-N |
| XLogP | 3.26 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |