C20H22N2O3S — CID 66821129
(3aS,10bS)-2-methyl-8-(2-methylsulfonylphenyl)-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepin-6-one (PubChem CID 66821129) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is (3aS,10bS)-2-methyl-8-(2-methylsulfonylphenyl)-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepin-6-one.
| Compound Name | (3aS,10bS)-2-methyl-8-(2-methylsulfonylphenyl)-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepin-6-one |
|---|---|
| PubChem CID | 66821129 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | (3aS,10bS)-2-methyl-8-(2-methylsulfonylphenyl)-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepin-6-one |
| SMILES | CN1C[C@@H]2CNC(=O)c3cc(-c4ccccc4S(C)(=O)=O)ccc3[C@H]2C1 |
| InChI | InChI=1S/C20H22N2O3S/c1-22-11-14-10-21-20(23)17-9-13(7-8-16(17)18(14)12-22)15-5-3-4-6-19(15)26(2,24)25/h3-9,14,18H,10-12H2,1-2H3,(H,21,23)/t14-,18-/m0/s1 |
| InChIKey | HYUGLAYQFPZOTK-KSSFIOAISA-N |
| XLogP | 2.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |