C21H22N2O2 — CID 67167347
(3aR,10bR)-8-(2,3-dihydro-1-benzofuran-5-yl)-2-methyl-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepin-6-one (PubChem CID 67167347) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is (3aR,10bR)-8-(2,3-dihydro-1-benzofuran-5-yl)-2-methyl-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepin-6-one.
| Compound Name | (3aR,10bR)-8-(2,3-dihydro-1-benzofuran-5-yl)-2-methyl-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepin-6-one |
|---|---|
| PubChem CID | 67167347 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | (3aR,10bR)-8-(2,3-dihydro-1-benzofuran-5-yl)-2-methyl-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepin-6-one |
| SMILES | CN1C[C@H]2CNC(=O)c3cc(-c4ccc5c(c4)CCO5)ccc3[C@@H]2C1 |
| InChI | InChI=1S/C21H22N2O2/c1-23-11-16-10-22-21(24)18-9-14(2-4-17(18)19(16)12-23)13-3-5-20-15(8-13)6-7-25-20/h2-5,8-9,16,19H,6-7,10-12H2,1H3,(H,22,24)/t16-,19-/m1/s1 |
| InChIKey | XHUYKRBJRGLDIX-VQIMIIECSA-N |
| XLogP | 2.68 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |