C15H20N2O — CID 23518413
(12S,16S)-14-methyl-6-oxa-10,14-diazatetracyclo[8.6.1.05,17.012,16]heptadeca-1(17),2,4-triene (PubChem CID 23518413) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is (12S,16S)-14-methyl-6-oxa-10,14-diazatetracyclo[8.6.1.05,17.012,16]heptadeca-1(17),2,4-triene.
| Compound Name | (12S,16S)-14-methyl-6-oxa-10,14-diazatetracyclo[8.6.1.05,17.012,16]heptadeca-1(17),2,4-triene |
|---|---|
| PubChem CID | 23518413 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (12S,16S)-14-methyl-6-oxa-10,14-diazatetracyclo[8.6.1.05,17.012,16]heptadeca-1(17),2,4-triene |
| SMILES | CN1C[C@H]2CN3CCCOc4cccc(c43)[C@H]2C1 |
| InChI | InChI=1S/C15H20N2O/c1-16-8-11-9-17-6-3-7-18-14-5-2-4-12(15(14)17)13(11)10-16/h2,4-5,11,13H,3,6-10H2,1H3/t11-,13-/m0/s1 |
| InChIKey | CXQBIVVBEYYDMF-AAEUAGOBSA-N |
| XLogP | 1.93 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |