C18H19NO — CID 67166354
(3aR,10bS)-2-phenyl-1,3,3a,4,5,10b-hexahydro-[1]benzoxepino[4,5-c]pyrrole (PubChem CID 67166354) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is (3aR,10bS)-2-phenyl-1,3,3a,4,5,10b-hexahydro-[1]benzoxepino[4,5-c]pyrrole.
| Compound Name | (3aR,10bS)-2-phenyl-1,3,3a,4,5,10b-hexahydro-[1]benzoxepino[4,5-c]pyrrole |
|---|---|
| PubChem CID | 67166354 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | (3aR,10bS)-2-phenyl-1,3,3a,4,5,10b-hexahydro-[1]benzoxepino[4,5-c]pyrrole |
| SMILES | c1ccc(N2C[C@@H]3CCOc4ccccc4[C@H]3C2)cc1 |
| InChI | InChI=1S/C18H19NO/c1-2-6-15(7-3-1)19-12-14-10-11-20-18-9-5-4-8-16(18)17(14)13-19/h1-9,14,17H,10-13H2/t14-,17-/m0/s1 |
| InChIKey | SIPMFPFJGLIIPC-YOEHRIQHSA-N |
| XLogP | 3.69 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |