C21H28BrN3O4 — CID 66828117
tert-butyl (2S)-2-[5-[4-bromo-3-(2-methoxyethoxy)phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 66828117) has the molecular formula C21H28BrN3O4 and a molecular weight of 466.38 g/mol. Its IUPAC name is tert-butyl (2S)-2-[5-[4-bromo-3-(2-methoxyethoxy)phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[5-[4-bromo-3-(2-methoxyethoxy)phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66828117 |
| Molecular Formula | C21H28BrN3O4 |
| Molecular Weight | 466.38 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | tert-butyl (2S)-2-[5-[4-bromo-3-(2-methoxyethoxy)phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | COCCOc1cc(-c2cnc([C@@H]3CCCN3C(=O)OC(C)(C)C)[nH]2)ccc1Br |
| InChI | InChI=1S/C21H28BrN3O4/c1-21(2,3)29-20(26)25-9-5-6-17(25)19-23-13-16(24-19)14-7-8-15(22)18(12-14)28-11-10-27-4/h7-8,12-13,17H,5-6,9-11H2,1-4H3,(H,23,24)/t17-/m0/s1 |
| InChIKey | YDWPKOGSAJHCKQ-KRWDZBQOSA-N |
| XLogP | 4.94 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.38 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|