C9H10N2O2 — CID 66828831
4-methoxy-6,7-dihydro-5H-quinazolin-8-one (PubChem CID 66828831) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is 4-methoxy-6,7-dihydro-5H-quinazolin-8-one.
| Compound Name | 4-methoxy-6,7-dihydro-5H-quinazolin-8-one |
|---|---|
| PubChem CID | 66828831 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 4-methoxy-6,7-dihydro-5H-quinazolin-8-one |
| SMILES | COc1ncnc2c1CCCC2=O |
| InChI | InChI=1S/C9H10N2O2/c1-13-9-6-3-2-4-7(12)8(6)10-5-11-9/h5H,2-4H2,1H3 |
| InChIKey | ZUXXGHOLPLBGJE-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |