C14H18N2O2 — CID 15279355
4-(5,6,7,8-tetrahydroquinazolin-4-yloxy)cyclohexan-1-one (PubChem CID 15279355) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 4-(5,6,7,8-tetrahydroquinazolin-4-yloxy)cyclohexan-1-one.
| Compound Name | 4-(5,6,7,8-tetrahydroquinazolin-4-yloxy)cyclohexan-1-one |
|---|---|
| PubChem CID | 15279355 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 4-(5,6,7,8-tetrahydroquinazolin-4-yloxy)cyclohexan-1-one |
| SMILES | O=C1CCC(Oc2ncnc3c2CCCC3)CC1 |
| InChI | InChI=1S/C14H18N2O2/c17-10-5-7-11(8-6-10)18-14-12-3-1-2-4-13(12)15-9-16-14/h9,11H,1-8H2 |
| InChIKey | JDVCKOSHUCUEAZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |