C23H32N2O3 — CID 66832875
tert-butyl N-[(2S)-5-(benzylamino)-4-hydroxy-1-phenylpentan-2-yl]carbamate (PubChem CID 66832875) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is tert-butyl N-[(2S)-5-(benzylamino)-4-hydroxy-1-phenylpentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-5-(benzylamino)-4-hydroxy-1-phenylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 66832875 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | tert-butyl N-[(2S)-5-(benzylamino)-4-hydroxy-1-phenylpentan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)CC(O)CNCc1ccccc1 |
| InChI | InChI=1S/C23H32N2O3/c1-23(2,3)28-22(27)25-20(14-18-10-6-4-7-11-18)15-21(26)17-24-16-19-12-8-5-9-13-19/h4-13,20-21,24,26H,14-17H2,1-3H3,(H,25,27)/t20-,21?/m0/s1 |
| InChIKey | VEHNHBHXXKIUHB-BGERDNNASA-N |
| XLogP | 3.66 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |