C10H10N2O4 — CID 66838839
3-methylidenepyrrolidine-2,5-dione;3-methylpyrrole-2,5-dione (PubChem CID 66838839) has the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. Its IUPAC name is 3-methylidenepyrrolidine-2,5-dione;3-methylpyrrole-2,5-dione.
| Compound Name | 3-methylidenepyrrolidine-2,5-dione;3-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 66838839 |
| Molecular Formula | C10H10N2O4 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 3-methylidenepyrrolidine-2,5-dione;3-methylpyrrole-2,5-dione |
| SMILES | C=C1CC(=O)NC1=O.CC1=CC(=O)NC1=O |
| InChI | InChI=1S/2C5H5NO2/c2*1-3-2-4(7)6-5(3)8/h2H,1H3,(H,6,7,8);1-2H2,(H,6,7,8) |
| InChIKey | RHYZLZWOILIKKZ-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|