C16H24N2O5 — CID 66839987
4-[4-(4-aminobutyl)phenoxy]-2-(carboxymethylamino)butanoic acid (PubChem CID 66839987) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is 4-[4-(4-aminobutyl)phenoxy]-2-(carboxymethylamino)butanoic acid.
| Compound Name | 4-[4-(4-aminobutyl)phenoxy]-2-(carboxymethylamino)butanoic acid |
|---|---|
| PubChem CID | 66839987 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 4-[4-(4-aminobutyl)phenoxy]-2-(carboxymethylamino)butanoic acid |
| SMILES | NCCCCc1ccc(OCCC(NCC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C16H24N2O5/c17-9-2-1-3-12-4-6-13(7-5-12)23-10-8-14(16(21)22)18-11-15(19)20/h4-7,14,18H,1-3,8-11,17H2,(H,19,20)(H,21,22) |
| InChIKey | DNRLTJHYDIWGMD-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|