C26H27N3O3 — CID 66840052
[4-[1-(2-methyl-5-phenylfuran-3-carbonyl)azetidin-3-yl]piperazin-1-yl]-phenylmethanone (PubChem CID 66840052) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is [4-[1-(2-methyl-5-phenylfuran-3-carbonyl)azetidin-3-yl]piperazin-1-yl]-phenylmethanone.
| Compound Name | [4-[1-(2-methyl-5-phenylfuran-3-carbonyl)azetidin-3-yl]piperazin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 66840052 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | [4-[1-(2-methyl-5-phenylfuran-3-carbonyl)azetidin-3-yl]piperazin-1-yl]-phenylmethanone |
| SMILES | Cc1oc(-c2ccccc2)cc1C(=O)N1CC(N2CCN(C(=O)c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C26H27N3O3/c1-19-23(16-24(32-19)20-8-4-2-5-9-20)26(31)29-17-22(18-29)27-12-14-28(15-13-27)25(30)21-10-6-3-7-11-21/h2-11,16,22H,12-15,17-18H2,1H3 |
| InChIKey | MIPJDMZZCTXHBK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 57.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |