C19H31N3O4S — CID 66842956
tert-butyl (Z)-2-cyano-3-[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]-3-methylsulfanylprop-2-enoate (PubChem CID 66842956) has the molecular formula C19H31N3O4S and a molecular weight of 397.54 g/mol. Its IUPAC name is tert-butyl (Z)-2-cyano-3-[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]-3-methylsulfanylprop-2-enoate.
| Compound Name | tert-butyl (Z)-2-cyano-3-[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]-3-methylsulfanylprop-2-enoate |
|---|---|
| PubChem CID | 66842956 |
| Molecular Formula | C19H31N3O4S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | tert-butyl (Z)-2-cyano-3-[(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]piperidin-1-yl]-3-methylsulfanylprop-2-enoate |
| SMILES | CS/C(=C(/C#N)C(=O)OC(C)(C)C)N1CCC[C@@H](NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H31N3O4S/c1-18(2,3)25-16(23)14(11-20)15(27-7)22-10-8-9-13(12-22)21-17(24)26-19(4,5)6/h13H,8-10,12H2,1-7H3,(H,21,24)/b15-14-/t13-/m1/s1 |
| InChIKey | IVCPDTNLEQLFJF-FARYLTDUSA-N |
| XLogP | 3.42 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|