C25H25Cl3N4O2 — CID 66844508
2-(2-butoxypropan-2-yl)-5-[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]-1,3,4-oxadiazole (PubChem CID 66844508) has the molecular formula C25H25Cl3N4O2 and a molecular weight of 519.86 g/mol. Its IUPAC name is 2-(2-butoxypropan-2-yl)-5-[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]-1,3,4-oxadiazole.
| Compound Name | 2-(2-butoxypropan-2-yl)-5-[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 66844508 |
| Molecular Formula | C25H25Cl3N4O2 |
| Molecular Weight | 519.86 g/mol |
| Exact Mass | 518.10 |
| IUPAC Name | 2-(2-butoxypropan-2-yl)-5-[5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4-methylpyrazol-3-yl]-1,3,4-oxadiazole |
| SMILES | CCCCOC(C)(C)c1nnc(-c2nn(-c3ccc(Cl)cc3Cl)c(-c3ccc(Cl)cc3)c2C)o1 |
| InChI | InChI=1S/C25H25Cl3N4O2/c1-5-6-13-33-25(3,4)24-30-29-23(34-24)21-15(2)22(16-7-9-17(26)10-8-16)32(31-21)20-12-11-18(27)14-19(20)28/h7-12,14H,5-6,13H2,1-4H3 |
| InChIKey | GIZKRFLQDFWIJQ-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 65.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.86 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|