C18H19FN4O3 — CID 66844580
[1-[2-(5-cyano-7-fluoro-2-oxoquinolin-1-yl)ethyl]piperidin-4-yl]carbamic acid (PubChem CID 66844580) has the molecular formula C18H19FN4O3 and a molecular weight of 358.37 g/mol. Its IUPAC name is [1-[2-(5-cyano-7-fluoro-2-oxoquinolin-1-yl)ethyl]piperidin-4-yl]carbamic acid.
| Compound Name | [1-[2-(5-cyano-7-fluoro-2-oxoquinolin-1-yl)ethyl]piperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 66844580 |
| Molecular Formula | C18H19FN4O3 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | [1-[2-(5-cyano-7-fluoro-2-oxoquinolin-1-yl)ethyl]piperidin-4-yl]carbamic acid |
| SMILES | N#Cc1cc(F)cc2c1ccc(=O)n2CCN1CCC(NC(=O)O)CC1 |
| InChI | InChI=1S/C18H19FN4O3/c19-13-9-12(11-20)15-1-2-17(24)23(16(15)10-13)8-7-22-5-3-14(4-6-22)21-18(25)26/h1-2,9-10,14,21H,3-8H2,(H,25,26) |
| InChIKey | QEQJHKLGWWHJAK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |