C18H19N5O3 — CID 67548902
[1-[(5-cyano-11-oxo-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-3-yl)methyl]piperidin-4-yl]carbamic acid (PubChem CID 67548902) has the molecular formula C18H19N5O3 and a molecular weight of 353.38 g/mol. Its IUPAC name is [1-[(5-cyano-11-oxo-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-3-yl)methyl]piperidin-4-yl]carbamic acid.
| Compound Name | [1-[(5-cyano-11-oxo-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-3-yl)methyl]piperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 67548902 |
| Molecular Formula | C18H19N5O3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | [1-[(5-cyano-11-oxo-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-3-yl)methyl]piperidin-4-yl]carbamic acid |
| SMILES | N#Cc1cnc2ccc(=O)n3c2c1C(CN1CCC(NC(=O)O)CC1)C3 |
| InChI | InChI=1S/C18H19N5O3/c19-7-11-8-20-14-1-2-15(24)23-10-12(16(11)17(14)23)9-22-5-3-13(4-6-22)21-18(25)26/h1-2,8,12-13,21H,3-6,9-10H2,(H,25,26) |
| InChIKey | QDRYFGXAMFVQRS-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 111.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |