C33H32ClF3N2O4 — CID 66846375
3-[[4-[(2R)-2-[5-chloro-1-[3-(trifluoromethyl)phenyl]indole-2-carbonyl]heptyl]benzoyl]amino]propanoic acid (PubChem CID 66846375) has the molecular formula C33H32ClF3N2O4 and a molecular weight of 613.08 g/mol. Its IUPAC name is 3-[[4-[(2R)-2-[5-chloro-1-[3-(trifluoromethyl)phenyl]indole-2-carbonyl]heptyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[(2R)-2-[5-chloro-1-[3-(trifluoromethyl)phenyl]indole-2-carbonyl]heptyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 66846375 |
| Molecular Formula | C33H32ClF3N2O4 |
| Molecular Weight | 613.08 g/mol |
| Exact Mass | 612.20 |
| IUPAC Name | 3-[[4-[(2R)-2-[5-chloro-1-[3-(trifluoromethyl)phenyl]indole-2-carbonyl]heptyl]benzoyl]amino]propanoic acid |
| SMILES | CCCCC[C@H](Cc1ccc(C(=O)NCCC(=O)O)cc1)C(=O)c1cc2cc(Cl)ccc2n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C33H32ClF3N2O4/c1-2-3-4-6-23(17-21-9-11-22(12-10-21)32(43)38-16-15-30(40)41)31(42)29-19-24-18-26(34)13-14-28(24)39(29)27-8-5-7-25(20-27)33(35,36)37/h5,7-14,18-20,23H,2-4,6,15-17H2,1H3,(H,38,43)(H,40,41)/t23-/m1/s1 |
| InChIKey | NMYGSMGORGHTCL-HSZRJFAPSA-N |
| XLogP | 8.13 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.08 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|