C17H17NO2 — CID 66849500
4-phenyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinolin-6-ol (PubChem CID 66849500) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 4-phenyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinolin-6-ol.
| Compound Name | 4-phenyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinolin-6-ol |
|---|---|
| PubChem CID | 66849500 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 4-phenyl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinolin-6-ol |
| SMILES | Oc1cccc2c1NC(c1ccccc1)C1CCOC21 |
| InChI | InChI=1S/C17H17NO2/c19-14-8-4-7-12-16(14)18-15(11-5-2-1-3-6-11)13-9-10-20-17(12)13/h1-8,13,15,17-19H,9-10H2 |
| InChIKey | OWYBYIRQJYHJLT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|