C15H13F3N4O4 — CID 66849700
6-[4-[2-(trifluoromethyl)furan-3-carbonyl]piperazin-1-yl]pyridazine-3-carboxylic acid (PubChem CID 66849700) has the molecular formula C15H13F3N4O4 and a molecular weight of 370.29 g/mol. Its IUPAC name is 6-[4-[2-(trifluoromethyl)furan-3-carbonyl]piperazin-1-yl]pyridazine-3-carboxylic acid.
| Compound Name | 6-[4-[2-(trifluoromethyl)furan-3-carbonyl]piperazin-1-yl]pyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 66849700 |
| Molecular Formula | C15H13F3N4O4 |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 6-[4-[2-(trifluoromethyl)furan-3-carbonyl]piperazin-1-yl]pyridazine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(N2CCN(C(=O)c3ccoc3C(F)(F)F)CC2)nn1 |
| InChI | InChI=1S/C15H13F3N4O4/c16-15(17,18)12-9(3-8-26-12)13(23)22-6-4-21(5-7-22)11-2-1-10(14(24)25)19-20-11/h1-3,8H,4-7H2,(H,24,25) |
| InChIKey | RPMZOOPHKCPBMB-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |