C17H15F3N4O4 — CID 66850153
6-[4-[2-(trifluoromethoxy)benzoyl]piperazin-1-yl]pyridazine-3-carboxylic acid (PubChem CID 66850153) has the molecular formula C17H15F3N4O4 and a molecular weight of 396.33 g/mol. Its IUPAC name is 6-[4-[2-(trifluoromethoxy)benzoyl]piperazin-1-yl]pyridazine-3-carboxylic acid.
| Compound Name | 6-[4-[2-(trifluoromethoxy)benzoyl]piperazin-1-yl]pyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 66850153 |
| Molecular Formula | C17H15F3N4O4 |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 6-[4-[2-(trifluoromethoxy)benzoyl]piperazin-1-yl]pyridazine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(N2CCN(C(=O)c3ccccc3OC(F)(F)F)CC2)nn1 |
| InChI | InChI=1S/C17H15F3N4O4/c18-17(19,20)28-13-4-2-1-3-11(13)15(25)24-9-7-23(8-10-24)14-6-5-12(16(26)27)21-22-14/h1-6H,7-10H2,(H,26,27) |
| InChIKey | PATFGTPDXJCKCV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |