C15H15Br2FN4 — CID 66854252
N-[(4-bromo-2-fluorophenyl)methyl]-1-(5-bromopyrimidin-2-yl)pyrrolidin-3-amine (PubChem CID 66854252) has the molecular formula C15H15Br2FN4 and a molecular weight of 430.12 g/mol. Its IUPAC name is N-[(4-bromo-2-fluorophenyl)methyl]-1-(5-bromopyrimidin-2-yl)pyrrolidin-3-amine.
| Compound Name | N-[(4-bromo-2-fluorophenyl)methyl]-1-(5-bromopyrimidin-2-yl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 66854252 |
| Molecular Formula | C15H15Br2FN4 |
| Molecular Weight | 430.12 g/mol |
| Exact Mass | 427.96 |
| IUPAC Name | N-[(4-bromo-2-fluorophenyl)methyl]-1-(5-bromopyrimidin-2-yl)pyrrolidin-3-amine |
| SMILES | Fc1cc(Br)ccc1CNC1CCN(c2ncc(Br)cn2)C1 |
| InChI | InChI=1S/C15H15Br2FN4/c16-11-2-1-10(14(18)5-11)6-19-13-3-4-22(9-13)15-20-7-12(17)8-21-15/h1-2,5,7-8,13,19H,3-4,6,9H2 |
| InChIKey | JBCUKEKMQLHFBF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.12 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |