C16H17BrClF2N3 — CID 68963775
N-[(4-bromo-2-fluorophenyl)methyl]-1-(6-fluoro-3-pyridinyl)pyrrolidin-3-amine;hydrochloride (PubChem CID 68963775) has the molecular formula C16H17BrClF2N3 and a molecular weight of 404.69 g/mol. Its IUPAC name is N-[(4-bromo-2-fluorophenyl)methyl]-1-(6-fluoro-3-pyridinyl)pyrrolidin-3-amine;hydrochloride.
| Compound Name | N-[(4-bromo-2-fluorophenyl)methyl]-1-(6-fluoro-3-pyridinyl)pyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 68963775 |
| Molecular Formula | C16H17BrClF2N3 |
| Molecular Weight | 404.69 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | N-[(4-bromo-2-fluorophenyl)methyl]-1-(6-fluoro-3-pyridinyl)pyrrolidin-3-amine;hydrochloride |
| SMILES | Cl.Fc1ccc(N2CCC(NCc3ccc(Br)cc3F)C2)cn1 |
| InChI | InChI=1S/C16H16BrF2N3.ClH/c17-12-2-1-11(15(18)7-12)8-20-13-5-6-22(10-13)14-3-4-16(19)21-9-14;/h1-4,7,9,13,20H,5-6,8,10H2;1H |
| InChIKey | FKHCQXYMXCEIAG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.69 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|