C13H13Cl2FN4S — CID 66870035
N-[(4,5-dichloro-1,2-thiazol-3-yl)methyl]-1-(6-fluoro-3-pyridinyl)pyrrolidin-3-amine (PubChem CID 66870035) has the molecular formula C13H13Cl2FN4S and a molecular weight of 347.25 g/mol. Its IUPAC name is N-[(4,5-dichloro-1,2-thiazol-3-yl)methyl]-1-(6-fluoro-3-pyridinyl)pyrrolidin-3-amine.
| Compound Name | N-[(4,5-dichloro-1,2-thiazol-3-yl)methyl]-1-(6-fluoro-3-pyridinyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 66870035 |
| Molecular Formula | C13H13Cl2FN4S |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | N-[(4,5-dichloro-1,2-thiazol-3-yl)methyl]-1-(6-fluoro-3-pyridinyl)pyrrolidin-3-amine |
| SMILES | Fc1ccc(N2CCC(NCc3nsc(Cl)c3Cl)C2)cn1 |
| InChI | InChI=1S/C13H13Cl2FN4S/c14-12-10(19-21-13(12)15)6-17-8-3-4-20(7-8)9-1-2-11(16)18-5-9/h1-2,5,8,17H,3-4,6-7H2 |
| InChIKey | IFLSMISFHTWRCN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|