C16H18ClFIN3 — CID 68959450
(3S)-1-(6-fluoro-3-pyridinyl)-N-[(4-iodophenyl)methyl]pyrrolidin-3-amine;hydrochloride (PubChem CID 68959450) has the molecular formula C16H18ClFIN3 and a molecular weight of 433.70 g/mol. Its IUPAC name is (3S)-1-(6-fluoro-3-pyridinyl)-N-[(4-iodophenyl)methyl]pyrrolidin-3-amine;hydrochloride.
| Compound Name | (3S)-1-(6-fluoro-3-pyridinyl)-N-[(4-iodophenyl)methyl]pyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 68959450 |
| Molecular Formula | C16H18ClFIN3 |
| Molecular Weight | 433.70 g/mol |
| Exact Mass | 433.02 |
| IUPAC Name | (3S)-1-(6-fluoro-3-pyridinyl)-N-[(4-iodophenyl)methyl]pyrrolidin-3-amine;hydrochloride |
| SMILES | Cl.Fc1ccc(N2CC[C@H](NCc3ccc(I)cc3)C2)cn1 |
| InChI | InChI=1S/C16H17FIN3.ClH/c17-16-6-5-15(10-20-16)21-8-7-14(11-21)19-9-12-1-3-13(18)4-2-12;/h1-6,10,14,19H,7-9,11H2;1H/t14-;/m0./s1 |
| InChIKey | VWZFRFBJVMIULL-UQKRIMTDSA-N |
| XLogP | 3.62 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.70 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|