C19H21N3O4 — CID 66854415
ethyl 4-oxo-3-(3-phenylprop-2-enoylamino)-6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrimidine-1-carboxylate (PubChem CID 66854415) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is ethyl 4-oxo-3-(3-phenylprop-2-enoylamino)-6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrimidine-1-carboxylate.
| Compound Name | ethyl 4-oxo-3-(3-phenylprop-2-enoylamino)-6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrimidine-1-carboxylate |
|---|---|
| PubChem CID | 66854415 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | ethyl 4-oxo-3-(3-phenylprop-2-enoylamino)-6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrimidine-1-carboxylate |
| SMILES | CCOC(=O)N1C=C(NC(=O)C=Cc2ccccc2)C(=O)N2CCCC12 |
| InChI | InChI=1S/C19H21N3O4/c1-2-26-19(25)22-13-15(18(24)21-12-6-9-17(21)22)20-16(23)11-10-14-7-4-3-5-8-14/h3-5,7-8,10-11,13,17H,2,6,9,12H2,1H3,(H,20,23) |
| InChIKey | GEPNGHSJUPXYNP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|