C16H16Cl2IN3 — CID 66854641
(3S)-N-[(2,4-dichlorophenyl)methyl]-1-(5-iodo-2-pyridinyl)pyrrolidin-3-amine (PubChem CID 66854641) has the molecular formula C16H16Cl2IN3 and a molecular weight of 448.14 g/mol. Its IUPAC name is (3S)-N-[(2,4-dichlorophenyl)methyl]-1-(5-iodo-2-pyridinyl)pyrrolidin-3-amine.
| Compound Name | (3S)-N-[(2,4-dichlorophenyl)methyl]-1-(5-iodo-2-pyridinyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 66854641 |
| Molecular Formula | C16H16Cl2IN3 |
| Molecular Weight | 448.14 g/mol |
| Exact Mass | 446.98 |
| IUPAC Name | (3S)-N-[(2,4-dichlorophenyl)methyl]-1-(5-iodo-2-pyridinyl)pyrrolidin-3-amine |
| SMILES | Clc1ccc(CN[C@H]2CCN(c3ccc(I)cn3)C2)c(Cl)c1 |
| InChI | InChI=1S/C16H16Cl2IN3/c17-12-2-1-11(15(18)7-12)8-20-14-5-6-22(10-14)16-4-3-13(19)9-21-16/h1-4,7,9,14,20H,5-6,8,10H2/t14-/m0/s1 |
| InChIKey | WIORBUMEWTWWRA-AWEZNQCLSA-N |
| XLogP | 4.36 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.14 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|