C15H15Cl2N3O2S — CID 77197484
N-[(2,4-dichlorophenyl)methyl]-1-(5-nitrothiophen-2-yl)pyrrolidin-3-amine (PubChem CID 77197484) has the molecular formula C15H15Cl2N3O2S and a molecular weight of 372.28 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-1-(5-nitrothiophen-2-yl)pyrrolidin-3-amine.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-1-(5-nitrothiophen-2-yl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 77197484 |
| Molecular Formula | C15H15Cl2N3O2S |
| Molecular Weight | 372.28 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-1-(5-nitrothiophen-2-yl)pyrrolidin-3-amine |
| SMILES | O=[N+]([O-])c1ccc(N2CCC(NCc3ccc(Cl)cc3Cl)C2)s1 |
| InChI | InChI=1S/C15H15Cl2N3O2S/c16-11-2-1-10(13(17)7-11)8-18-12-5-6-19(9-12)14-3-4-15(23-14)20(21)22/h1-4,7,12,18H,5-6,8-9H2 |
| InChIKey | HIADZICBUZLGGR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.28 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|