C13H15N3O — CID 66854704
N-[[3-(1H-pyrazol-5-yl)phenyl]methyl]propanamide (PubChem CID 66854704) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is N-[[3-(1H-pyrazol-5-yl)phenyl]methyl]propanamide.
| Compound Name | N-[[3-(1H-pyrazol-5-yl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 66854704 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | N-[[3-(1H-pyrazol-5-yl)phenyl]methyl]propanamide |
| SMILES | CCC(=O)NCc1cccc(-c2ccn[nH]2)c1 |
| InChI | InChI=1S/C13H15N3O/c1-2-13(17)14-9-10-4-3-5-11(8-10)12-6-7-15-16-12/h3-8H,2,9H2,1H3,(H,14,17)(H,15,16) |
| InChIKey | VUYBLDAVKMKRRM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |