C23H22ClF4N7O — CID 66858718
5-[5-chloro-1-[4-(trifluoromethoxy)phenyl]pentyl]-N-[3-fluoro-4-(5-methyl-1,2,4-triazol-1-yl)phenyl]-1H-1,2,4-triazol-3-amine (PubChem CID 66858718) has the molecular formula C23H22ClF4N7O and a molecular weight of 523.92 g/mol. Its IUPAC name is 5-[5-chloro-1-[4-(trifluoromethoxy)phenyl]pentyl]-N-[3-fluoro-4-(5-methyl-1,2,4-triazol-1-yl)phenyl]-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-[5-chloro-1-[4-(trifluoromethoxy)phenyl]pentyl]-N-[3-fluoro-4-(5-methyl-1,2,4-triazol-1-yl)phenyl]-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 66858718 |
| Molecular Formula | C23H22ClF4N7O |
| Molecular Weight | 523.92 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | 5-[5-chloro-1-[4-(trifluoromethoxy)phenyl]pentyl]-N-[3-fluoro-4-(5-methyl-1,2,4-triazol-1-yl)phenyl]-1H-1,2,4-triazol-3-amine |
| SMILES | Cc1ncnn1-c1ccc(Nc2n[nH]c(C(CCCCCl)c3ccc(OC(F)(F)F)cc3)n2)cc1F |
| InChI | InChI=1S/C23H22ClF4N7O/c1-14-29-13-30-35(14)20-10-7-16(12-19(20)25)31-22-32-21(33-34-22)18(4-2-3-11-24)15-5-8-17(9-6-15)36-23(26,27)28/h5-10,12-13,18H,2-4,11H2,1H3,(H2,31,32,33,34) |
| InChIKey | QTHNQLYKGVVPJQ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 93.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.92 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|