C18H10Cl2FNO3 — CID 66858904
3-[6-(2,4-dichlorophenoxy)-2-pyridinyl]-2-fluorobenzoic acid (PubChem CID 66858904) has the molecular formula C18H10Cl2FNO3 and a molecular weight of 378.19 g/mol. Its IUPAC name is 3-[6-(2,4-dichlorophenoxy)-2-pyridinyl]-2-fluorobenzoic acid.
| Compound Name | 3-[6-(2,4-dichlorophenoxy)-2-pyridinyl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 66858904 |
| Molecular Formula | C18H10Cl2FNO3 |
| Molecular Weight | 378.19 g/mol |
| Exact Mass | 377.00 |
| IUPAC Name | 3-[6-(2,4-dichlorophenoxy)-2-pyridinyl]-2-fluorobenzoic acid |
| SMILES | O=C(O)c1cccc(-c2cccc(Oc3ccc(Cl)cc3Cl)n2)c1F |
| InChI | InChI=1S/C18H10Cl2FNO3/c19-10-7-8-15(13(20)9-10)25-16-6-2-5-14(22-16)11-3-1-4-12(17(11)21)18(23)24/h1-9H,(H,23,24) |
| InChIKey | LIABKHWUERWFQX-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.19 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |