C19H13Cl2NO3 — CID 66857600
3-[6-(2,4-dichlorophenoxy)-2-pyridinyl]-4-methylbenzoic acid (PubChem CID 66857600) has the molecular formula C19H13Cl2NO3 and a molecular weight of 374.22 g/mol. Its IUPAC name is 3-[6-(2,4-dichlorophenoxy)-2-pyridinyl]-4-methylbenzoic acid.
| Compound Name | 3-[6-(2,4-dichlorophenoxy)-2-pyridinyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 66857600 |
| Molecular Formula | C19H13Cl2NO3 |
| Molecular Weight | 374.22 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 3-[6-(2,4-dichlorophenoxy)-2-pyridinyl]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1-c1cccc(Oc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C19H13Cl2NO3/c1-11-5-6-12(19(23)24)9-14(11)16-3-2-4-18(22-16)25-17-8-7-13(20)10-15(17)21/h2-10H,1H3,(H,23,24) |
| InChIKey | CQKGYMSWIXLEPE-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.22 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |