3-[6-(2,4-dichlorophenoxy)-2-pyridinyl]-4-methylbenzoic acid

C19H13Cl2NO3 — CID 66857600

IUPAC3-[6-(2,4-dichlorophenoxy)-2-pyridinyl]-4-methylbenzoic acid
SMILESCc1ccc(C(=O)O)cc1-c1cccc(Oc2ccc(Cl)cc2Cl)n1
InChIInChI=1S/C19H13Cl2NO3/c1-11-5-6-12(19(23)24)9-14(11)16-3-2-4-18(22-16)25-17-8-7-13(20)10-15(17)21/h2-10H,1H3,(H,23,24)
InChIKeyCQKGYMSWIXLEPE-UHFFFAOYSA-N
MW374.22 g/mol
LogP5.85
Rot. Bonds4

About 3-[6-(2,4-dichlorophenoxy)-2-pyridinyl]-4-methylbenzoic acid

3-[6-(2,4-dichlorophenoxy)-2-pyridinyl]-4-methylbenzoic acid (PubChem CID 66857600) has the molecular formula C19H13Cl2NO3 and a molecular weight of 374.22 g/mol. Its IUPAC name is 3-[6-(2,4-dichlorophenoxy)-2-pyridinyl]-4-methylbenzoic acid.

Molecular Properties

Compound Name3-[6-(2,4-dichlorophenoxy)-2-pyridinyl]-4-methylbenzoic acid
PubChem CID66857600
Molecular FormulaC19H13Cl2NO3
Molecular Weight374.22 g/mol
Exact Mass373.03
IUPAC Name3-[6-(2,4-dichlorophenoxy)-2-pyridinyl]-4-methylbenzoic acid
SMILESCc1ccc(C(=O)O)cc1-c1cccc(Oc2ccc(Cl)cc2Cl)n1
InChIInChI=1S/C19H13Cl2NO3/c1-11-5-6-12(19(23)24)9-14(11)16-3-2-4-18(22-16)25-17-8-7-13(20)10-15(17)21/h2-10H,1H3,(H,23,24)
InChIKeyCQKGYMSWIXLEPE-UHFFFAOYSA-N
XLogP5.85
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms25
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500374.22
LogP ≤ 55.85
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-[6-(2,4-dichlorophenoxy)-2-pyridinyl]-4-methylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[6-(2,4-dichlorophenoxy)-2-pyridinyl]-4-methylbenzoic acid?
The IUPAC name of 3-[6-(2,4-dichlorophenoxy)-2-pyridinyl]-4-methylbenzoic acid (CID 66857600) is 3-[6-(2,4-dichlorophenoxy)-2-pyridinyl]-4-methylbenzoic acid.
What is the SMILES notation for 3-[6-(2,4-dichlorophenoxy)-2-pyridinyl]-4-methylbenzoic acid?
The canonical SMILES for 3-[6-(2,4-dichlorophenoxy)-2-pyridinyl]-4-methylbenzoic acid is Cc1ccc(C(=O)O)cc1-c1cccc(Oc2ccc(Cl)cc2Cl)n1.
What is the InChIKey of 3-[6-(2,4-dichlorophenoxy)-2-pyridinyl]-4-methylbenzoic acid?
The InChIKey is CQKGYMSWIXLEPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13Cl2NO3/c1-11-5-6-12(19(23)24)9-14(11)16-3-2-4-18(22-16)25-17-8-7-13(20)10-15(17)21/h2-10H,1H3,(H,23,24).
What are the key properties of 3-[6-(2,4-dichlorophenoxy)-2-pyridinyl]-4-methylbenzoic acid?
3-[6-(2,4-dichlorophenoxy)-2-pyridinyl]-4-methylbenzoic acid has a molecular weight of 374.22 g/mol, XLogP of 5.85, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-(2,4-dichlorophenoxy)-2-pyridinyl]-4-methylbenzoic acid is sourced from PubChem (CID 66857600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).