C12H9Cl2NO2 — CID 62240040
[6-(2,4-dichlorophenoxy)-2-pyridinyl]methanol (PubChem CID 62240040) has the molecular formula C12H9Cl2NO2 and a molecular weight of 270.12 g/mol. Its IUPAC name is [6-(2,4-dichlorophenoxy)-2-pyridinyl]methanol.
| Compound Name | [6-(2,4-dichlorophenoxy)-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 62240040 |
| Molecular Formula | C12H9Cl2NO2 |
| Molecular Weight | 270.12 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | [6-(2,4-dichlorophenoxy)-2-pyridinyl]methanol |
| SMILES | OCc1cccc(Oc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C12H9Cl2NO2/c13-8-4-5-11(10(14)6-8)17-12-3-1-2-9(7-16)15-12/h1-6,16H,7H2 |
| InChIKey | WCEDVYBSZPIIQJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.12 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |