C25H25N3O3 — CID 66860637
ethyl (E)-3-[1,3-dimethyl-5-(6-phenylmethoxyindol-1-yl)pyrazol-4-yl]prop-2-enoate (PubChem CID 66860637) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is ethyl (E)-3-[1,3-dimethyl-5-(6-phenylmethoxyindol-1-yl)pyrazol-4-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[1,3-dimethyl-5-(6-phenylmethoxyindol-1-yl)pyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 66860637 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | ethyl (E)-3-[1,3-dimethyl-5-(6-phenylmethoxyindol-1-yl)pyrazol-4-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1c(C)nn(C)c1-n1ccc2ccc(OCc3ccccc3)cc21 |
| InChI | InChI=1S/C25H25N3O3/c1-4-30-24(29)13-12-22-18(2)26-27(3)25(22)28-15-14-20-10-11-21(16-23(20)28)31-17-19-8-6-5-7-9-19/h5-16H,4,17H2,1-3H3/b13-12+ |
| InChIKey | BOIYRPDYMXGAOE-OUKQBFOZSA-N |
| XLogP | 4.83 |
| TPSA | 58.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|