C19H21N3O2 — CID 77197942
ethyl 3-[1,3-dimethyl-5-(5-methylindol-1-yl)pyrazol-4-yl]prop-2-enoate (PubChem CID 77197942) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is ethyl 3-[1,3-dimethyl-5-(5-methylindol-1-yl)pyrazol-4-yl]prop-2-enoate.
| Compound Name | ethyl 3-[1,3-dimethyl-5-(5-methylindol-1-yl)pyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 77197942 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | ethyl 3-[1,3-dimethyl-5-(5-methylindol-1-yl)pyrazol-4-yl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1c(C)nn(C)c1-n1ccc2cc(C)ccc21 |
| InChI | InChI=1S/C19H21N3O2/c1-5-24-18(23)9-7-16-14(3)20-21(4)19(16)22-11-10-15-12-13(2)6-8-17(15)22/h6-12H,5H2,1-4H3 |
| InChIKey | JJWJBYLGBLUGHS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|