C20H23ClN4O4S — CID 91116542
butylsulfamoyl 3-[5-(5-chloroindol-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enoate (PubChem CID 91116542) has the molecular formula C20H23ClN4O4S and a molecular weight of 450.95 g/mol. Its IUPAC name is butylsulfamoyl 3-[5-(5-chloroindol-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enoate.
| Compound Name | butylsulfamoyl 3-[5-(5-chloroindol-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 91116542 |
| Molecular Formula | C20H23ClN4O4S |
| Molecular Weight | 450.95 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | butylsulfamoyl 3-[5-(5-chloroindol-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enoate |
| SMILES | CCCCNS(=O)(=O)OC(=O)C=Cc1c(C)nn(C)c1-n1ccc2cc(Cl)ccc21 |
| InChI | InChI=1S/C20H23ClN4O4S/c1-4-5-11-22-30(27,28)29-19(26)9-7-17-14(2)23-24(3)20(17)25-12-10-15-13-16(21)6-8-18(15)25/h6-10,12-13,22H,4-5,11H2,1-3H3 |
| InChIKey | DXJWHLUQTOVULY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.95 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|