C21H23N3O4 — CID 66858645
ethyl (E)-3-[1,3-dimethyl-5-[6-(2-oxopropoxy)indol-1-yl]pyrazol-4-yl]prop-2-enoate (PubChem CID 66858645) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is ethyl (E)-3-[1,3-dimethyl-5-[6-(2-oxopropoxy)indol-1-yl]pyrazol-4-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[1,3-dimethyl-5-[6-(2-oxopropoxy)indol-1-yl]pyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 66858645 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | ethyl (E)-3-[1,3-dimethyl-5-[6-(2-oxopropoxy)indol-1-yl]pyrazol-4-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1c(C)nn(C)c1-n1ccc2ccc(OCC(C)=O)cc21 |
| InChI | InChI=1S/C21H23N3O4/c1-5-27-20(26)9-8-18-15(3)22-23(4)21(18)24-11-10-16-6-7-17(12-19(16)24)28-13-14(2)25/h6-12H,5,13H2,1-4H3/b9-8+ |
| InChIKey | GNSSEDYPVCPXTC-CMDGGOBGSA-N |
| XLogP | 3.22 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|