C18H13F3N2OS — CID 66864550
2,4-dimethyl-N-[2-(2,4,5-trifluorophenyl)phenyl]-1,3-thiazole-5-carboxamide (PubChem CID 66864550) has the molecular formula C18H13F3N2OS and a molecular weight of 362.38 g/mol. Its IUPAC name is 2,4-dimethyl-N-[2-(2,4,5-trifluorophenyl)phenyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2,4-dimethyl-N-[2-(2,4,5-trifluorophenyl)phenyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 66864550 |
| Molecular Formula | C18H13F3N2OS |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 2,4-dimethyl-N-[2-(2,4,5-trifluorophenyl)phenyl]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(C)c(C(=O)Nc2ccccc2-c2cc(F)c(F)cc2F)s1 |
| InChI | InChI=1S/C18H13F3N2OS/c1-9-17(25-10(2)22-9)18(24)23-16-6-4-3-5-11(16)12-7-14(20)15(21)8-13(12)19/h3-8H,1-2H3,(H,23,24) |
| InChIKey | OWALHKXFDYYVCM-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|