C25H35ClN3O6+ — CID 66870004
1-[(2S)-2-[(2-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]-N-[(2R,3S)-3-ethoxy-5-oxooxolan-2-yl]piperidin-1-ium-1-carboxamide (PubChem CID 66870004) has the molecular formula C25H35ClN3O6+ and a molecular weight of 509.02 g/mol. Its IUPAC name is 1-[(2S)-2-[(2-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]-N-[(2R,3S)-3-ethoxy-5-oxooxolan-2-yl]piperidin-1-ium-1-carboxamide.
| Compound Name | 1-[(2S)-2-[(2-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]-N-[(2R,3S)-3-ethoxy-5-oxooxolan-2-yl]piperidin-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 66870004 |
| Molecular Formula | C25H35ClN3O6+ |
| Molecular Weight | 509.02 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | 1-[(2S)-2-[(2-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]-N-[(2R,3S)-3-ethoxy-5-oxooxolan-2-yl]piperidin-1-ium-1-carboxamide |
| SMILES | CCO[C@H]1CC(=O)O[C@H]1NC(=O)[N+]1(C(=O)[C@@H](NC(=O)c2ccccc2Cl)C(C)(C)C)CCCCC1 |
| InChI | InChI=1S/C25H34ClN3O6/c1-5-34-18-15-19(30)35-22(18)28-24(33)29(13-9-6-10-14-29)23(32)20(25(2,3)4)27-21(31)16-11-7-8-12-17(16)26/h7-8,11-12,18,20,22H,5-6,9-10,13-15H2,1-4H3,(H-,27,28,31,33)/p+1/t18-,20+,22+/m0/s1 |
| InChIKey | NRDZDSLGAIMBTG-CZTZKLFOSA-O |
| XLogP | 3.40 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.02 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|