C20H31N3O4 — CID 66870684
3-(butoxycarbonylamino)-2-[4-[(4-methylphenyl)methyl]piperazin-1-yl]propanoic acid (PubChem CID 66870684) has the molecular formula C20H31N3O4 and a molecular weight of 377.49 g/mol. Its IUPAC name is 3-(butoxycarbonylamino)-2-[4-[(4-methylphenyl)methyl]piperazin-1-yl]propanoic acid.
| Compound Name | 3-(butoxycarbonylamino)-2-[4-[(4-methylphenyl)methyl]piperazin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 66870684 |
| Molecular Formula | C20H31N3O4 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | 3-(butoxycarbonylamino)-2-[4-[(4-methylphenyl)methyl]piperazin-1-yl]propanoic acid |
| SMILES | CCCCOC(=O)NCC(C(=O)O)N1CCN(Cc2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C20H31N3O4/c1-3-4-13-27-20(26)21-14-18(19(24)25)23-11-9-22(10-12-23)15-17-7-5-16(2)6-8-17/h5-8,18H,3-4,9-15H2,1-2H3,(H,21,26)(H,24,25) |
| InChIKey | UTMUIGNXBDXQNF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|