C24H29NO6 — CID 135333043
3-(butoxycarbonylamino)-2-[4-[(2,4-dimethylbenzoyl)oxymethyl]phenyl]propanoic acid (PubChem CID 135333043) has the molecular formula C24H29NO6 and a molecular weight of 427.50 g/mol. Its IUPAC name is 3-(butoxycarbonylamino)-2-[4-[(2,4-dimethylbenzoyl)oxymethyl]phenyl]propanoic acid.
| Compound Name | 3-(butoxycarbonylamino)-2-[4-[(2,4-dimethylbenzoyl)oxymethyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 135333043 |
| Molecular Formula | C24H29NO6 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 3-(butoxycarbonylamino)-2-[4-[(2,4-dimethylbenzoyl)oxymethyl]phenyl]propanoic acid |
| SMILES | CCCCOC(=O)NCC(C(=O)O)c1ccc(COC(=O)c2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C24H29NO6/c1-4-5-12-30-24(29)25-14-21(22(26)27)19-9-7-18(8-10-19)15-31-23(28)20-11-6-16(2)13-17(20)3/h6-11,13,21H,4-5,12,14-15H2,1-3H3,(H,25,29)(H,26,27) |
| InChIKey | VDOZEZODVNMEMU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|