C18H14BrClNO4PS — CID 66872013
[2-[2-(2-bromophenyl)ethenylamino]-1-(5-chloro-1-benzothiophen-3-yl)-2-oxoethyl]phosphonic acid (PubChem CID 66872013) has the molecular formula C18H14BrClNO4PS and a molecular weight of 486.71 g/mol. Its IUPAC name is [2-[2-(2-bromophenyl)ethenylamino]-1-(5-chloro-1-benzothiophen-3-yl)-2-oxoethyl]phosphonic acid.
| Compound Name | [2-[2-(2-bromophenyl)ethenylamino]-1-(5-chloro-1-benzothiophen-3-yl)-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 66872013 |
| Molecular Formula | C18H14BrClNO4PS |
| Molecular Weight | 486.71 g/mol |
| Exact Mass | 484.93 |
| IUPAC Name | [2-[2-(2-bromophenyl)ethenylamino]-1-(5-chloro-1-benzothiophen-3-yl)-2-oxoethyl]phosphonic acid |
| SMILES | O=C(NC=Cc1ccccc1Br)C(c1csc2ccc(Cl)cc12)P(=O)(O)O |
| InChI | InChI=1S/C18H14BrClNO4PS/c19-15-4-2-1-3-11(15)7-8-21-18(22)17(26(23,24)25)14-10-27-16-6-5-12(20)9-13(14)16/h1-10,17H,(H,21,22)(H2,23,24,25) |
| InChIKey | QTWALPVOVPRQJF-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.71 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|