C18H13ClF2NO4PS — CID 68929472
[1-(5-chloro-1-benzothiophen-3-yl)-2-[[(E)-2-(2,4-difluorophenyl)ethenyl]amino]-2-oxoethyl]phosphonic acid (PubChem CID 68929472) has the molecular formula C18H13ClF2NO4PS and a molecular weight of 443.80 g/mol. Its IUPAC name is [1-(5-chloro-1-benzothiophen-3-yl)-2-[[(E)-2-(2,4-difluorophenyl)ethenyl]amino]-2-oxoethyl]phosphonic acid.
| Compound Name | [1-(5-chloro-1-benzothiophen-3-yl)-2-[[(E)-2-(2,4-difluorophenyl)ethenyl]amino]-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 68929472 |
| Molecular Formula | C18H13ClF2NO4PS |
| Molecular Weight | 443.80 g/mol |
| Exact Mass | 443.00 |
| IUPAC Name | [1-(5-chloro-1-benzothiophen-3-yl)-2-[[(E)-2-(2,4-difluorophenyl)ethenyl]amino]-2-oxoethyl]phosphonic acid |
| SMILES | O=C(N/C=C/c1ccc(F)cc1F)C(c1csc2ccc(Cl)cc12)P(=O)(O)O |
| InChI | InChI=1S/C18H13ClF2NO4PS/c19-11-2-4-16-13(7-11)14(9-28-16)17(27(24,25)26)18(23)22-6-5-10-1-3-12(20)8-15(10)21/h1-9,17H,(H,22,23)(H2,24,25,26)/b6-5+ |
| InChIKey | GPMSOWWCPNFYSL-AATRIKPKSA-N |
| XLogP | 4.84 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.80 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|