C26H59NO5Si3 — CID 66872681
1-[3-[bis[[tert-butyl(dimethyl)silyl]oxy]-methylsilyl]propoxy]-3-[4-(2-hydroxyethyl)piperidin-1-yl]propan-2-ol (PubChem CID 66872681) has the molecular formula C26H59NO5Si3 and a molecular weight of 550.02 g/mol. Its IUPAC name is 1-[3-[bis[[tert-butyl(dimethyl)silyl]oxy]-methylsilyl]propoxy]-3-[4-(2-hydroxyethyl)piperidin-1-yl]propan-2-ol.
| Compound Name | 1-[3-[bis[[tert-butyl(dimethyl)silyl]oxy]-methylsilyl]propoxy]-3-[4-(2-hydroxyethyl)piperidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 66872681 |
| Molecular Formula | C26H59NO5Si3 |
| Molecular Weight | 550.02 g/mol |
| Exact Mass | 549.37 |
| IUPAC Name | 1-[3-[bis[[tert-butyl(dimethyl)silyl]oxy]-methylsilyl]propoxy]-3-[4-(2-hydroxyethyl)piperidin-1-yl]propan-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[Si](C)(CCCOCC(O)CN1CCC(CCO)CC1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H59NO5Si3/c1-25(2,3)33(7,8)31-35(11,32-34(9,10)26(4,5)6)20-12-19-30-22-24(29)21-27-16-13-23(14-17-27)15-18-28/h23-24,28-29H,12-22H2,1-11H3 |
| InChIKey | UGILMVPKUGEKHR-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.02 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|