(3-bromothiophen-2-yl)carbamic acid

C5H4BrNO2S — CID 66875367

IUPAC(3-bromothiophen-2-yl)carbamic acid
SMILESO=C(O)Nc1sccc1Br
InChIInChI=1S/C5H4BrNO2S/c6-3-1-2-10-4(3)7-5(8)9/h1-2,7H,(H,8,9)
InChIKeyFDFZGQOAURASNN-UHFFFAOYSA-N
MW222.06 g/mol
LogP2.60
Rot. Bonds1

About (3-bromothiophen-2-yl)carbamic acid

(3-bromothiophen-2-yl)carbamic acid (PubChem CID 66875367) has the molecular formula C5H4BrNO2S and a molecular weight of 222.06 g/mol. Its IUPAC name is (3-bromothiophen-2-yl)carbamic acid.

Molecular Properties

Compound Name(3-bromothiophen-2-yl)carbamic acid
PubChem CID66875367
Molecular FormulaC5H4BrNO2S
Molecular Weight222.06 g/mol
Exact Mass220.91
IUPAC Name(3-bromothiophen-2-yl)carbamic acid
SMILESO=C(O)Nc1sccc1Br
InChIInChI=1S/C5H4BrNO2S/c6-3-1-2-10-4(3)7-5(8)9/h1-2,7H,(H,8,9)
InChIKeyFDFZGQOAURASNN-UHFFFAOYSA-N
XLogP2.60
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.06
LogP ≤ 52.60
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (3-bromothiophen-2-yl)carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3-bromothiophen-2-yl)carbamic acid?
The IUPAC name of (3-bromothiophen-2-yl)carbamic acid (CID 66875367) is (3-bromothiophen-2-yl)carbamic acid.
What is the SMILES notation for (3-bromothiophen-2-yl)carbamic acid?
The canonical SMILES for (3-bromothiophen-2-yl)carbamic acid is O=C(O)Nc1sccc1Br.
What is the InChIKey of (3-bromothiophen-2-yl)carbamic acid?
The InChIKey is FDFZGQOAURASNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4BrNO2S/c6-3-1-2-10-4(3)7-5(8)9/h1-2,7H,(H,8,9).
What are the key properties of (3-bromothiophen-2-yl)carbamic acid?
(3-bromothiophen-2-yl)carbamic acid has a molecular weight of 222.06 g/mol, XLogP of 2.60, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromothiophen-2-yl)carbamic acid is sourced from PubChem (CID 66875367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).