C14H15N3O4S — CID 66880835
[3-[(3-aminophenyl)methylsulfonylamino]phenyl]carbamic acid (PubChem CID 66880835) has the molecular formula C14H15N3O4S and a molecular weight of 321.36 g/mol. Its IUPAC name is [3-[(3-aminophenyl)methylsulfonylamino]phenyl]carbamic acid.
| Compound Name | [3-[(3-aminophenyl)methylsulfonylamino]phenyl]carbamic acid |
|---|---|
| PubChem CID | 66880835 |
| Molecular Formula | C14H15N3O4S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | [3-[(3-aminophenyl)methylsulfonylamino]phenyl]carbamic acid |
| SMILES | Nc1cccc(CS(=O)(=O)Nc2cccc(NC(=O)O)c2)c1 |
| InChI | InChI=1S/C14H15N3O4S/c15-11-4-1-3-10(7-11)9-22(20,21)17-13-6-2-5-12(8-13)16-14(18)19/h1-8,16-17H,9,15H2,(H,18,19) |
| InChIKey | MRIGKCZPWKHRPJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|