C24H23FN6O3 — CID 66888729
8-[3-fluoro-4-[(2R)-2-methylmorpholin-4-yl]anilino]-6-(2-methoxypyrimidin-5-yl)-2H-2,7-naphthyridin-1-one (PubChem CID 66888729) has the molecular formula C24H23FN6O3 and a molecular weight of 462.49 g/mol. Its IUPAC name is 8-[3-fluoro-4-[(2R)-2-methylmorpholin-4-yl]anilino]-6-(2-methoxypyrimidin-5-yl)-2H-2,7-naphthyridin-1-one.
| Compound Name | 8-[3-fluoro-4-[(2R)-2-methylmorpholin-4-yl]anilino]-6-(2-methoxypyrimidin-5-yl)-2H-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 66888729 |
| Molecular Formula | C24H23FN6O3 |
| Molecular Weight | 462.49 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 8-[3-fluoro-4-[(2R)-2-methylmorpholin-4-yl]anilino]-6-(2-methoxypyrimidin-5-yl)-2H-2,7-naphthyridin-1-one |
| SMILES | COc1ncc(-c2cc3cc[nH]c(=O)c3c(Nc3ccc(N4CCO[C@H](C)C4)c(F)c3)n2)cn1 |
| InChI | InChI=1S/C24H23FN6O3/c1-14-13-31(7-8-34-14)20-4-3-17(10-18(20)25)29-22-21-15(5-6-26-23(21)32)9-19(30-22)16-11-27-24(33-2)28-12-16/h3-6,9-12,14H,7-8,13H2,1-2H3,(H,26,32)(H,29,30)/t14-/m1/s1 |
| InChIKey | UTRFEXWJYCTEAQ-CQSZACIVSA-N |
| XLogP | 3.50 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|