C23H28N4O2 — CID 58166678
8-[3-methyl-4-[(2R)-2-methylmorpholin-4-yl]anilino]-6-propan-2-yl-2H-2,7-naphthyridin-1-one (PubChem CID 58166678) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 8-[3-methyl-4-[(2R)-2-methylmorpholin-4-yl]anilino]-6-propan-2-yl-2H-2,7-naphthyridin-1-one.
| Compound Name | 8-[3-methyl-4-[(2R)-2-methylmorpholin-4-yl]anilino]-6-propan-2-yl-2H-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 58166678 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 8-[3-methyl-4-[(2R)-2-methylmorpholin-4-yl]anilino]-6-propan-2-yl-2H-2,7-naphthyridin-1-one |
| SMILES | Cc1cc(Nc2nc(C(C)C)cc3cc[nH]c(=O)c23)ccc1N1CCO[C@H](C)C1 |
| InChI | InChI=1S/C23H28N4O2/c1-14(2)19-12-17-7-8-24-23(28)21(17)22(26-19)25-18-5-6-20(15(3)11-18)27-9-10-29-16(4)13-27/h5-8,11-12,14,16H,9-10,13H2,1-4H3,(H,24,28)(H,25,26)/t16-/m1/s1 |
| InChIKey | DATQOUMDUXZQOI-MRXNPFEDSA-N |
| XLogP | 4.32 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|