About 6-chloro-8-[3-methyl-4-[(3S)-3-methylazepan-1-yl]anilino]-2H-2,7-naphthyridin-1-one
6-chloro-8-[3-methyl-4-[(3S)-3-methylazepan-1-yl]anilino]-2H-2,7-naphthyridin-1-one (PubChem CID 89162091) has the molecular formula C22H25ClN4O
and a molecular weight of 396.92 g/mol. Its IUPAC name is 6-chloro-8-[3-methyl-4-[(3S)-3-methylazepan-1-yl]anilino]-2H-2,7-naphthyridin-1-one.
Molecular Properties
| Compound Name | 6-chloro-8-[3-methyl-4-[(3S)-3-methylazepan-1-yl]anilino]-2H-2,7-naphthyridin-1-one |
| PubChem CID | 89162091 |
| Molecular Formula | C22H25ClN4O |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 6-chloro-8-[3-methyl-4-[(3S)-3-methylazepan-1-yl]anilino]-2H-2,7-naphthyridin-1-one |
| SMILES | Cc1cc(Nc2nc(Cl)cc3cc[nH]c(=O)c23)ccc1N1CCCC[C@H](C)C1 |
| InChI | InChI=1S/C22H25ClN4O/c1-14-5-3-4-10-27(13-14)18-7-6-17(11-15(18)2)25-21-20-16(12-19(23)26-21)8-9-24-22(20)28/h6-9,11-12,14H,3-5,10,13H2,1-2H3,(H,24,28)(H,25,26)/t14-/m0/s1 |
| InChIKey | YJFBJFBMXMGYTK-AWEZNQCLSA-N |
| XLogP | 5.25 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-8-[3-methyl-4-[(3S)-3-methylazepan-1-yl]anilino]-2H-2,7-naphthyridin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-8-[3-methyl-4-[(3S)-3-methylazepan-1-yl]anilino]-2H-2,7-naphthyridin-1-one?
The IUPAC name of 6-chloro-8-[3-methyl-4-[(3S)-3-methylazepan-1-yl]anilino]-2H-2,7-naphthyridin-1-one (CID 89162091) is 6-chloro-8-[3-methyl-4-[(3S)-3-methylazepan-1-yl]anilino]-2H-2,7-naphthyridin-1-one.
What is the SMILES notation for 6-chloro-8-[3-methyl-4-[(3S)-3-methylazepan-1-yl]anilino]-2H-2,7-naphthyridin-1-one?
The canonical SMILES for 6-chloro-8-[3-methyl-4-[(3S)-3-methylazepan-1-yl]anilino]-2H-2,7-naphthyridin-1-one is Cc1cc(Nc2nc(Cl)cc3cc[nH]c(=O)c23)ccc1N1CCCC[C@H](C)C1.
What is the InChIKey of 6-chloro-8-[3-methyl-4-[(3S)-3-methylazepan-1-yl]anilino]-2H-2,7-naphthyridin-1-one?
The InChIKey is YJFBJFBMXMGYTK-AWEZNQCLSA-N. The full InChI is InChI=1S/C22H25ClN4O/c1-14-5-3-4-10-27(13-14)18-7-6-17(11-15(18)2)25-21-20-16(12-19(23)26-21)8-9-24-22(20)28/h6-9,11-12,14H,3-5,10,13H2,1-2H3,(H,24,28)(H,25,26)/t14-/m0/s1.
What are the key properties of 6-chloro-8-[3-methyl-4-[(3S)-3-methylazepan-1-yl]anilino]-2H-2,7-naphthyridin-1-one?
6-chloro-8-[3-methyl-4-[(3S)-3-methylazepan-1-yl]anilino]-2H-2,7-naphthyridin-1-one has a molecular weight of 396.92 g/mol, XLogP of 5.25, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-8-[3-methyl-4-[(3S)-3-methylazepan-1-yl]anilino]-2H-2,7-naphthyridin-1-one is sourced from PubChem (CID 89162091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).