C24H30N4O3 — CID 58167282
6-(1-ethoxyethyl)-8-[3-methyl-4-[(2R)-2-methylmorpholin-4-yl]anilino]-2H-2,7-naphthyridin-1-one (PubChem CID 58167282) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is 6-(1-ethoxyethyl)-8-[3-methyl-4-[(2R)-2-methylmorpholin-4-yl]anilino]-2H-2,7-naphthyridin-1-one.
| Compound Name | 6-(1-ethoxyethyl)-8-[3-methyl-4-[(2R)-2-methylmorpholin-4-yl]anilino]-2H-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 58167282 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 6-(1-ethoxyethyl)-8-[3-methyl-4-[(2R)-2-methylmorpholin-4-yl]anilino]-2H-2,7-naphthyridin-1-one |
| SMILES | CCOC(C)c1cc2cc[nH]c(=O)c2c(Nc2ccc(N3CCO[C@H](C)C3)c(C)c2)n1 |
| InChI | InChI=1S/C24H30N4O3/c1-5-30-17(4)20-13-18-8-9-25-24(29)22(18)23(27-20)26-19-6-7-21(15(2)12-19)28-10-11-31-16(3)14-28/h6-9,12-13,16-17H,5,10-11,14H2,1-4H3,(H,25,29)(H,26,27)/t16-,17?/m1/s1 |
| InChIKey | YJILQVPDMXGPDO-TZHYSIJRSA-N |
| XLogP | 4.30 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|